C14H24N4O2S2 — CID 4041337
1-[3-(dimethylamino)propyl]-3-[3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 4041337) has the molecular formula C14H24N4O2S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 4041337 |
| Molecular Formula | C14H24N4O2S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | CN(C)CCCNC(=S)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C14H24N4O2S2/c1-17(2)10-6-9-15-14(21)16-12-7-5-8-13(11-12)22(19,20)18(3)4/h5,7-8,11H,6,9-10H2,1-4H3,(H2,15,16,21) |
| InChIKey | FOXHNTJUHDDPHC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|