C15H15Cl2N3O2S2 — CID 3962779
1-(3,4-dichlorophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 3962779) has the molecular formula C15H15Cl2N3O2S2 and a molecular weight of 404.34 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 3962779 |
| Molecular Formula | C15H15Cl2N3O2S2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H15Cl2N3O2S2/c1-20(2)24(21,22)12-5-3-4-10(8-12)18-15(23)19-11-6-7-13(16)14(17)9-11/h3-9H,1-2H3,(H2,18,19,23) |
| InChIKey | AKNWGQAREHXKET-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|