C14H13Cl2N3O3S — CID 26721473
3,6-dichloro-N-[3-(dimethylsulfamoyl)phenyl]pyridine-2-carboxamide (PubChem CID 26721473) has the molecular formula C14H13Cl2N3O3S and a molecular weight of 374.25 g/mol. Its IUPAC name is 3,6-dichloro-N-[3-(dimethylsulfamoyl)phenyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[3-(dimethylsulfamoyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26721473 |
| Molecular Formula | C14H13Cl2N3O3S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 3,6-dichloro-N-[3-(dimethylsulfamoyl)phenyl]pyridine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)c2nc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N3O3S/c1-19(2)23(21,22)10-5-3-4-9(8-10)17-14(20)13-11(15)6-7-12(16)18-13/h3-8H,1-2H3,(H,17,20) |
| InChIKey | AUGAVYLFSLNJQP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|