C12H9Cl2N3O3S — CID 26718791
3,6-dichloro-N-(4-sulfamoylphenyl)pyridine-2-carboxamide (PubChem CID 26718791) has the molecular formula C12H9Cl2N3O3S and a molecular weight of 346.20 g/mol. Its IUPAC name is 3,6-dichloro-N-(4-sulfamoylphenyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(4-sulfamoylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26718791 |
| Molecular Formula | C12H9Cl2N3O3S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 3,6-dichloro-N-(4-sulfamoylphenyl)pyridine-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2nc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C12H9Cl2N3O3S/c13-9-5-6-10(14)17-11(9)12(18)16-7-1-3-8(4-2-7)21(15,19)20/h1-6H,(H,16,18)(H2,15,19,20) |
| InChIKey | MABASRXGJSCBQI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|