C10H9ClN4O3S — CID 19579274
4-chloro-N-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19579274) has the molecular formula C10H9ClN4O3S and a molecular weight of 300.73 g/mol. Its IUPAC name is 4-chloro-N-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19579274 |
| Molecular Formula | C10H9ClN4O3S |
| Molecular Weight | 300.73 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 4-chloro-N-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2[nH]ncc2Cl)cc1 |
| InChI | InChI=1S/C10H9ClN4O3S/c11-8-5-13-15-9(8)10(16)14-6-1-3-7(4-2-6)19(12,17)18/h1-5H,(H,13,15)(H,14,16)(H2,12,17,18) |
| InChIKey | OAVXJODLUBWSNY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.73 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |