C13H14N4O3S — CID 62234840
2-hydrazinyl-N-(4-sulfamoylphenyl)benzamide (PubChem CID 62234840) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-hydrazinyl-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-hydrazinyl-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 62234840 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-hydrazinyl-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NNc1ccccc1C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H14N4O3S/c14-17-12-4-2-1-3-11(12)13(18)16-9-5-7-10(8-6-9)21(15,19)20/h1-8,17H,14H2,(H,16,18)(H2,15,19,20) |
| InChIKey | RARGXZBSPMEEKY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|