C16H16N2O5S3 — CID 102090823
(2S)-2-[[2-[(4-sulfamoylphenyl)carbamoyl]phenyl]disulfanyl]propanoic acid (PubChem CID 102090823) has the molecular formula C16H16N2O5S3 and a molecular weight of 412.51 g/mol. Its IUPAC name is (2S)-2-[[2-[(4-sulfamoylphenyl)carbamoyl]phenyl]disulfanyl]propanoic acid.
| Compound Name | (2S)-2-[[2-[(4-sulfamoylphenyl)carbamoyl]phenyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 102090823 |
| Molecular Formula | C16H16N2O5S3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | (2S)-2-[[2-[(4-sulfamoylphenyl)carbamoyl]phenyl]disulfanyl]propanoic acid |
| SMILES | C[C@H](SSc1ccccc1C(=O)Nc1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C16H16N2O5S3/c1-10(16(20)21)24-25-14-5-3-2-4-13(14)15(19)18-11-6-8-12(9-7-11)26(17,22)23/h2-10H,1H3,(H,18,19)(H,20,21)(H2,17,22,23)/t10-/m0/s1 |
| InChIKey | BZHLQRVJOXSEKT-JTQLQIEISA-N |
| XLogP | 2.80 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|