C14H15N3O3S — CID 28554911
2-amino-3-methyl-N-(4-sulfamoylphenyl)benzamide (PubChem CID 28554911) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-amino-3-methyl-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 28554911 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-amino-3-methyl-N-(4-sulfamoylphenyl)benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)c1N |
| InChI | InChI=1S/C14H15N3O3S/c1-9-3-2-4-12(13(9)15)14(18)17-10-5-7-11(8-6-10)21(16,19)20/h2-8H,15H2,1H3,(H,17,18)(H2,16,19,20) |
| InChIKey | JAVMTHZXDRFKKT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|