C16H17N3O4S — CID 108508841
N'-(2,6-dimethylphenyl)-N-(4-sulfamoylphenyl)oxamide (PubChem CID 108508841) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-(2,6-dimethylphenyl)-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508841 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-(4-sulfamoylphenyl)oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H17N3O4S/c1-10-4-3-5-11(2)14(10)19-16(21)15(20)18-12-6-8-13(9-7-12)24(17,22)23/h3-9H,1-2H3,(H,18,20)(H,19,21)(H2,17,22,23) |
| InChIKey | PFAKOSVPGKJRMD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|