C17H20N2O4S — CID 9297225
(2R)-2-(2,6-dimethylphenoxy)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 9297225) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is (2R)-2-(2,6-dimethylphenoxy)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2R)-2-(2,6-dimethylphenoxy)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 9297225 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2R)-2-(2,6-dimethylphenoxy)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | Cc1cccc(C)c1O[C@H](C)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-11-5-4-6-12(2)16(11)23-13(3)17(20)19-14-7-9-15(10-8-14)24(18,21)22/h4-10,13H,1-3H3,(H,19,20)(H2,18,21,22)/t13-/m1/s1 |
| InChIKey | YJZDFHMMZPLNOO-CYBMUJFWSA-N |
| XLogP | 2.36 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |