C16H18N2O4S — CID 7371830
(2S)-2-(4-methylphenoxy)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 7371830) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is (2S)-2-(4-methylphenoxy)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2S)-2-(4-methylphenoxy)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 7371830 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2S)-2-(4-methylphenoxy)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | Cc1ccc(O[C@@H](C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-11-3-7-14(8-4-11)22-12(2)16(19)18-13-5-9-15(10-6-13)23(17,20)21/h3-10,12H,1-2H3,(H,18,19)(H2,17,20,21)/t12-/m0/s1 |
| InChIKey | RDTCMMCCWCMCAB-LBPRGKRZSA-N |
| XLogP | 2.05 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |