C17H19ClN2O4S — CID 19191667
2-(4-chloro-3,5-dimethylphenoxy)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 19191667) has the molecular formula C17H19ClN2O4S and a molecular weight of 382.87 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 19191667 |
| Molecular Formula | C17H19ClN2O4S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | Cc1cc(OC(C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C17H19ClN2O4S/c1-10-8-14(9-11(2)16(10)18)24-12(3)17(21)20-13-4-6-15(7-5-13)25(19,22)23/h4-9,12H,1-3H3,(H,20,21)(H2,19,22,23) |
| InChIKey | FYTNAXHHAAFHLI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |