C17H14F6N2O4S — CID 16526072
2-[3,5-bis(trifluoromethyl)phenoxy]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 16526072) has the molecular formula C17H14F6N2O4S and a molecular weight of 456.36 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 16526072 |
| Molecular Formula | C17H14F6N2O4S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H14F6N2O4S/c1-9(15(26)25-12-2-4-14(5-3-12)30(24,27)28)29-13-7-10(16(18,19)20)6-11(8-13)17(21,22)23/h2-9H,1H3,(H,25,26)(H2,24,27,28) |
| InChIKey | DUMQRVTUOZSMPX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |