C19H19F3N2O5S — CID 46812038
[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-(4-sulfamoylphenyl)propanoate (PubChem CID 46812038) has the molecular formula C19H19F3N2O5S and a molecular weight of 444.43 g/mol. Its IUPAC name is [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-(4-sulfamoylphenyl)propanoate.
| Compound Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-(4-sulfamoylphenyl)propanoate |
|---|---|
| PubChem CID | 46812038 |
| Molecular Formula | C19H19F3N2O5S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-(4-sulfamoylphenyl)propanoate |
| SMILES | CC(OC(=O)CCc1ccc(S(N)(=O)=O)cc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N2O5S/c1-12(18(26)24-15-7-5-14(6-8-15)19(20,21)22)29-17(25)11-4-13-2-9-16(10-3-13)30(23,27)28/h2-3,5-10,12H,4,11H2,1H3,(H,24,26)(H2,23,27,28) |
| InChIKey | MTFWEGXGOOOBGC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |