C20H20FNO4 — CID 8552348
[(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate (PubChem CID 8552348) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate.
| Compound Name | [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 8552348 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H](C)OC(=O)CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H20FNO4/c1-13(23)16-6-10-18(11-7-16)22-20(25)14(2)26-19(24)12-5-15-3-8-17(21)9-4-15/h3-4,6-11,14H,5,12H2,1-2H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | PYYVVOPBQSLYGU-CQSZACIVSA-N |
| XLogP | 3.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |