C21H20FNO5 — CID 7764174
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 7764174) has the molecular formula C21H20FNO5 and a molecular weight of 385.39 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7764174 |
| Molecular Formula | C21H20FNO5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)OC(=O)CCC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H20FNO5/c1-13(24)16-4-3-5-18(12-16)23-21(27)14(2)28-20(26)11-10-19(25)15-6-8-17(22)9-7-15/h3-9,12,14H,10-11H2,1-2H3,(H,23,27)/t14-/m1/s1 |
| InChIKey | BKVNJOYZULJOPU-CQSZACIVSA-N |
| XLogP | 3.56 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |