C19H16ClF2NO4 — CID 7764297
[(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 7764297) has the molecular formula C19H16ClF2NO4 and a molecular weight of 395.79 g/mol. Its IUPAC name is [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7764297 |
| Molecular Formula | C19H16ClF2NO4 |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | C[C@@H](OC(=O)CCC(=O)c1ccc(F)cc1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H16ClF2NO4/c1-11(19(26)23-16-7-6-14(22)10-15(16)20)27-18(25)9-8-17(24)12-2-4-13(21)5-3-12/h2-7,10-11H,8-9H2,1H3,(H,23,26)/t11-/m1/s1 |
| InChIKey | BZRWVJRENSVKBR-LLVKDONJSA-N |
| XLogP | 4.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |