C20H20ClFN2O4 — CID 55379997
[1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-benzamidobutanoate (PubChem CID 55379997) has the molecular formula C20H20ClFN2O4 and a molecular weight of 406.84 g/mol. Its IUPAC name is [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-benzamidobutanoate.
| Compound Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 55379997 |
| Molecular Formula | C20H20ClFN2O4 |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OC(C)C(=O)Nc1ccc(F)cc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20ClFN2O4/c1-12(23-20(27)14-6-4-3-5-7-14)10-18(25)28-13(2)19(26)24-17-9-8-15(22)11-16(17)21/h3-9,11-13H,10H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | SRCUKAYNQHVAJF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |