C20H21ClFNO5 — CID 7791131
[(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(2-propoxyphenoxy)acetate (PubChem CID 7791131) has the molecular formula C20H21ClFNO5 and a molecular weight of 409.84 g/mol. Its IUPAC name is [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(2-propoxyphenoxy)acetate.
| Compound Name | [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(2-propoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7791131 |
| Molecular Formula | C20H21ClFNO5 |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(2-propoxyphenoxy)acetate |
| SMILES | CCCOc1ccccc1OCC(=O)O[C@H](C)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H21ClFNO5/c1-3-10-26-17-6-4-5-7-18(17)27-12-19(24)28-13(2)20(25)23-16-9-8-14(22)11-15(16)21/h4-9,11,13H,3,10,12H2,1-2H3,(H,23,25)/t13-/m1/s1 |
| InChIKey | ZOWQBNKWLOXUGB-CYBMUJFWSA-N |
| XLogP | 4.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |