C21H23ClFNO4 — CID 7855481
[(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 7855481) has the molecular formula C21H23ClFNO4 and a molecular weight of 407.87 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 7855481 |
| Molecular Formula | C21H23ClFNO4 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H23ClFNO4/c1-13(20(26)24-18-10-7-15(23)11-17(18)22)28-19(25)12-27-16-8-5-14(6-9-16)21(2,3)4/h5-11,13H,12H2,1-4H3,(H,24,26)/t13-/m0/s1 |
| InChIKey | BSHGVHBAEPCGJG-ZDUSSCGKSA-N |
| XLogP | 4.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |