C18H14Cl2F3NO4 — CID 5073487
[1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(4-chlorophenoxy)acetate (PubChem CID 5073487) has the molecular formula C18H14Cl2F3NO4 and a molecular weight of 436.21 g/mol. Its IUPAC name is [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(4-chlorophenoxy)acetate.
| Compound Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 5073487 |
| Molecular Formula | C18H14Cl2F3NO4 |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(4-chlorophenoxy)acetate |
| SMILES | CC(OC(=O)COc1ccc(Cl)cc1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H14Cl2F3NO4/c1-10(28-16(25)9-27-13-5-3-12(19)4-6-13)17(26)24-15-8-11(18(21,22)23)2-7-14(15)20/h2-8,10H,9H2,1H3,(H,24,26) |
| InChIKey | MZRPNQLXYPGPOL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |