C19H16Cl2F3NO4 — CID 3275818
[1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(4-chlorophenoxy)propanoate (PubChem CID 3275818) has the molecular formula C19H16Cl2F3NO4 and a molecular weight of 450.24 g/mol. Its IUPAC name is [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(4-chlorophenoxy)propanoate.
| Compound Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(4-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 3275818 |
| Molecular Formula | C19H16Cl2F3NO4 |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(4-chlorophenoxy)propanoate |
| SMILES | CC(OC(=O)C(C)Oc1ccc(Cl)cc1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H16Cl2F3NO4/c1-10(29-18(27)11(2)28-14-6-4-13(20)5-7-14)17(26)25-16-9-12(19(22,23)24)3-8-15(16)21/h3-11H,1-2H3,(H,25,26) |
| InChIKey | SBXYDYMJHLYBTE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |