C20H23ClN2O4 — CID 7855516
[(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 7855516) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 7855516 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H23ClN2O4/c1-13(19(25)23-17-10-7-15(21)11-22-17)27-18(24)12-26-16-8-5-14(6-9-16)20(2,3)4/h5-11,13H,12H2,1-4H3,(H,22,23,25)/t13-/m1/s1 |
| InChIKey | JXQQXASHDYQOES-CYBMUJFWSA-N |
| XLogP | 3.98 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |