C16H14ClFN2O4 — CID 7791568
[(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4-fluorophenoxy)acetate (PubChem CID 7791568) has the molecular formula C16H14ClFN2O4 and a molecular weight of 352.75 g/mol. Its IUPAC name is [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 7791568 |
| Molecular Formula | C16H14ClFN2O4 |
| Molecular Weight | 352.75 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4-fluorophenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccc(F)cc1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H14ClFN2O4/c1-10(16(22)20-14-7-2-11(17)8-19-14)24-15(21)9-23-13-5-3-12(18)4-6-13/h2-8,10H,9H2,1H3,(H,19,20,22)/t10-/m1/s1 |
| InChIKey | IOKSGNCSJWGNRZ-SNVBAGLBSA-N |
| XLogP | 2.82 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |