C15H21NO4 — CID 9328058
[(2R)-1-amino-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 9328058) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 9328058 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccc(C(C)(C)C)cc1)C(N)=O |
| InChI | InChI=1S/C15H21NO4/c1-10(14(16)18)20-13(17)9-19-12-7-5-11(6-8-12)15(2,3)4/h5-8,10H,9H2,1-4H3,(H2,16,18)/t10-/m1/s1 |
| InChIKey | XHKWUHDQYPQYAU-SNVBAGLBSA-N |
| XLogP | 1.78 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |