C19H17FN2O3 — CID 8553222
[(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate (PubChem CID 8553222) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate.
| Compound Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 8553222 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccc(F)cc1)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H17FN2O3/c1-13(19(24)22-17-9-4-15(12-21)5-10-17)25-18(23)11-6-14-2-7-16(20)8-3-14/h2-5,7-10,13H,6,11H2,1H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | QSQFSCJBJVQBKN-CYBMUJFWSA-N |
| XLogP | 3.20 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |