C17H16N2O3S — CID 8654696
[(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate (PubChem CID 8654696) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate.
| Compound Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8654696 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccsc1)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H16N2O3S/c1-12(22-16(20)7-4-14-8-9-23-11-14)17(21)19-15-5-2-13(10-18)3-6-15/h2-3,5-6,8-9,11-12H,4,7H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | ATSNESUFRLKWJP-GFCCVEGCSA-N |
| XLogP | 3.12 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |