C17H17F2NO3S2 — CID 8959325
[(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate (PubChem CID 8959325) has the molecular formula C17H17F2NO3S2 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate.
| Compound Name | [(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8959325 |
| Molecular Formula | C17H17F2NO3S2 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | [(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccsc1)C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C17H17F2NO3S2/c1-11(23-15(21)7-2-12-8-9-24-10-12)16(22)20-13-3-5-14(6-4-13)25-17(18)19/h3-6,8-11,17H,2,7H2,1H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | HRQKBGLIZLJBFO-LLVKDONJSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |