C17H15ClN2O3S — CID 8959386
[(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate (PubChem CID 8959386) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate.
| Compound Name | [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8959386 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
| SMILES | C[C@H](OC(=O)CCc1ccsc1)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-11(23-16(21)5-2-12-6-7-24-10-12)17(22)20-14-4-3-13(9-19)15(18)8-14/h3-4,6-8,10-11H,2,5H2,1H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | CDXJHIAWLLCTGG-NSHDSACASA-N |
| XLogP | 3.78 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |