C18H22ClN3O4 — CID 55998131
[1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 6-acetamidohexanoate (PubChem CID 55998131) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 6-acetamidohexanoate.
| Compound Name | [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 6-acetamidohexanoate |
|---|---|
| PubChem CID | 55998131 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OC(C)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C18H22ClN3O4/c1-12(26-17(24)6-4-3-5-9-21-13(2)23)18(25)22-15-8-7-14(11-20)16(19)10-15/h7-8,10,12H,3-6,9H2,1-2H3,(H,21,23)(H,22,25) |
| InChIKey | GWNDHEIEPCJSBF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|