C19H29N3O4 — CID 8861348
[(2S)-1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] 6-(carbamoylamino)hexanoate (PubChem CID 8861348) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] 6-(carbamoylamino)hexanoate.
| Compound Name | [(2S)-1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8861348 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | [(2S)-1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] 6-(carbamoylamino)hexanoate |
| SMILES | CC(C)c1ccc(NC(=O)[C@H](C)OC(=O)CCCCCNC(N)=O)cc1 |
| InChI | InChI=1S/C19H29N3O4/c1-13(2)15-8-10-16(11-9-15)22-18(24)14(3)26-17(23)7-5-4-6-12-21-19(20)25/h8-11,13-14H,4-7,12H2,1-3H3,(H,22,24)(H3,20,21,25)/t14-/m0/s1 |
| InChIKey | XSEALRGUVNBOBU-AWEZNQCLSA-N |
| XLogP | 2.91 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|