C13H15ClFN3O4 — CID 8955391
[(2S)-1-(3-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-(carbamoylamino)propanoate (PubChem CID 8955391) has the molecular formula C13H15ClFN3O4 and a molecular weight of 331.73 g/mol. Its IUPAC name is [(2S)-1-(3-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-(carbamoylamino)propanoate.
| Compound Name | [(2S)-1-(3-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-(carbamoylamino)propanoate |
|---|---|
| PubChem CID | 8955391 |
| Molecular Formula | C13H15ClFN3O4 |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [(2S)-1-(3-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-(carbamoylamino)propanoate |
| SMILES | C[C@H](OC(=O)CCNC(N)=O)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClFN3O4/c1-7(22-11(19)4-5-17-13(16)21)12(20)18-8-2-3-10(15)9(14)6-8/h2-3,6-7H,4-5H2,1H3,(H,18,20)(H3,16,17,21)/t7-/m0/s1 |
| InChIKey | ZYVSLJKMNIQQIQ-ZETCQYMHSA-N |
| XLogP | 1.41 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |