C17H24ClN3O4 — CID 9308290
[(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate (PubChem CID 9308290) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate.
| Compound Name | [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 9308290 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H](C)OC(=O)CCCCCNC(N)=O |
| InChI | InChI=1S/C17H24ClN3O4/c1-11-7-8-13(18)10-14(11)21-16(23)12(2)25-15(22)6-4-3-5-9-20-17(19)24/h7-8,10,12H,3-6,9H2,1-2H3,(H,21,23)(H3,19,20,24)/t12-/m1/s1 |
| InChIKey | KKKMQTHJZLSHNB-GFCCVEGCSA-N |
| XLogP | 2.75 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|