C17H25NO3 — CID 8575763
[(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] 4-methylpentanoate (PubChem CID 8575763) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] 4-methylpentanoate.
| Compound Name | [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] 4-methylpentanoate |
|---|---|
| PubChem CID | 8575763 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] 4-methylpentanoate |
| SMILES | Cc1ccc(C)c(NC(=O)[C@H](C)OC(=O)CCC(C)C)c1 |
| InChI | InChI=1S/C17H25NO3/c1-11(2)6-9-16(19)21-14(5)17(20)18-15-10-12(3)7-8-13(15)4/h7-8,10-11,14H,6,9H2,1-5H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | UCYQDPGXKZGLDJ-AWEZNQCLSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |