C22H27NO3 — CID 7847973
[(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-methylpentanoate (PubChem CID 7847973) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-methylpentanoate.
| Compound Name | [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-methylpentanoate |
|---|---|
| PubChem CID | 7847973 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-methylpentanoate |
| SMILES | Cc1ccc(C)c(NC(=O)[C@@H](OC(=O)CCC(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C22H27NO3/c1-15(2)10-13-20(24)26-21(18-8-6-5-7-9-18)22(25)23-19-14-16(3)11-12-17(19)4/h5-9,11-12,14-15,21H,10,13H2,1-4H3,(H,23,25)/t21-/m0/s1 |
| InChIKey | UZNNCLJDRQTKPQ-NRFANRHFSA-N |
| XLogP | 4.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |