C20H22FNO3 — CID 7848093
[(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-methylpentanoate (PubChem CID 7848093) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-methylpentanoate.
| Compound Name | [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-methylpentanoate |
|---|---|
| PubChem CID | 7848093 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)O[C@H](C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H22FNO3/c1-14(2)8-13-18(23)25-19(15-6-4-3-5-7-15)20(24)22-17-11-9-16(21)10-12-17/h3-7,9-12,14,19H,8,13H2,1-2H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | XHCQCCAGOLHHHU-IBGZPJMESA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |