C19H21NO3 — CID 7796632
[(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl] butanoate (PubChem CID 7796632) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl] butanoate.
| Compound Name | [(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl] butanoate |
|---|---|
| PubChem CID | 7796632 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl] butanoate |
| SMILES | CCCC(=O)O[C@@H](C(=O)Nc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO3/c1-3-7-17(21)23-18(15-8-5-4-6-9-15)19(22)20-16-12-10-14(2)11-13-16/h4-6,8-13,18H,3,7H2,1-2H3,(H,20,22)/t18-/m1/s1 |
| InChIKey | KPVBNLOEHMXWER-GOSISDBHSA-N |
| XLogP | 4.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |