C17H16FNO3 — CID 42902056
[2-(4-fluoroanilino)-2-oxo-1-phenylethyl] propanoate (PubChem CID 42902056) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] propanoate.
| Compound Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] propanoate |
|---|---|
| PubChem CID | 42902056 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] propanoate |
| SMILES | CCC(=O)OC(C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H16FNO3/c1-2-15(20)22-16(12-6-4-3-5-7-12)17(21)19-14-10-8-13(18)9-11-14/h3-11,16H,2H2,1H3,(H,19,21) |
| InChIKey | FOGLLJIMRKBQEP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |