C22H24FNO3 — CID 78536179
[2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-cyclopentylpropanoate (PubChem CID 78536179) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 78536179 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-cyclopentylpropanoate |
| SMILES | O=C(CCC1CCCC1)OC(C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H24FNO3/c23-18-11-13-19(14-12-18)24-22(26)21(17-8-2-1-3-9-17)27-20(25)15-10-16-6-4-5-7-16/h1-3,8-9,11-14,16,21H,4-7,10,15H2,(H,24,26) |
| InChIKey | IQHNUCOPCCGWGE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |