C22H25FN2O3 — CID 122100950
3-[1-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]piperidin-3-yl]propanoic acid (PubChem CID 122100950) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 3-[1-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 122100950 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[1-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]piperidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCN(C(C(=O)Nc2ccc(F)cc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H25FN2O3/c23-18-9-11-19(12-10-18)24-22(28)21(17-6-2-1-3-7-17)25-14-4-5-16(15-25)8-13-20(26)27/h1-3,6-7,9-12,16,21H,4-5,8,13-15H2,(H,24,28)(H,26,27) |
| InChIKey | YSURGVDSHQUPPS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |