C22H19FN2O5 — CID 46795944
[2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-(furan-2-carbonylamino)propanoate (PubChem CID 46795944) has the molecular formula C22H19FN2O5 and a molecular weight of 410.40 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-(furan-2-carbonylamino)propanoate.
| Compound Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 46795944 |
| Molecular Formula | C22H19FN2O5 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-(furan-2-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)c1ccco1)OC(C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H19FN2O5/c23-16-8-10-17(11-9-16)25-22(28)20(15-5-2-1-3-6-15)30-19(26)12-13-24-21(27)18-7-4-14-29-18/h1-11,14,20H,12-13H2,(H,24,27)(H,25,28) |
| InChIKey | RUVYVGLIDDYJFD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |