C18H17N3O5 — CID 7909111
[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-(furan-2-carbonylamino)propanoate (PubChem CID 7909111) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-(furan-2-carbonylamino)propanoate.
| Compound Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 7909111 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-(furan-2-carbonylamino)propanoate |
| SMILES | C[C@H](OC(=O)CCNC(=O)c1ccco1)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H17N3O5/c1-12(17(23)21-14-6-4-13(11-19)5-7-14)26-16(22)8-9-20-18(24)15-3-2-10-25-15/h2-7,10,12H,8-9H2,1H3,(H,20,24)(H,21,23)/t12-/m0/s1 |
| InChIKey | ULYKXVFQUFDYCN-LBPRGKRZSA-N |
| XLogP | 1.84 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |