C20H18ClN3O4 — CID 7827276
[(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-[(4-chlorobenzoyl)amino]propanoate (PubChem CID 7827276) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-[(4-chlorobenzoyl)amino]propanoate.
| Compound Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-[(4-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827276 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 3-[(4-chlorobenzoyl)amino]propanoate |
| SMILES | C[C@@H](OC(=O)CCNC(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H18ClN3O4/c1-13(19(26)24-17-8-2-14(12-22)3-9-17)28-18(25)10-11-23-20(27)15-4-6-16(21)7-5-15/h2-9,13H,10-11H2,1H3,(H,23,27)(H,24,26)/t13-/m1/s1 |
| InChIKey | NCHUGQUUBNKDOO-CYBMUJFWSA-N |
| XLogP | 2.90 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |