C20H20ClN3O2 — CID 2523193
4-chloro-N-[(2R,3R)-1-(4-cyanoanilino)-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 2523193) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 4-chloro-N-[(2R,3R)-1-(4-cyanoanilino)-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(2R,3R)-1-(4-cyanoanilino)-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 2523193 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-chloro-N-[(2R,3R)-1-(4-cyanoanilino)-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H20ClN3O2/c1-3-13(2)18(24-19(25)15-6-8-16(21)9-7-15)20(26)23-17-10-4-14(12-22)5-11-17/h4-11,13,18H,3H2,1-2H3,(H,23,26)(H,24,25)/t13-,18-/m1/s1 |
| InChIKey | VXDYQTHDSLQYSL-FZKQIMNGSA-N |
| XLogP | 3.99 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |