C17H26ClN3O2 — CID 119504568
4-chloro-N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 119504568) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 119504568 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-chloro-N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CCNCCNC(=O)C(NC(=O)c1ccc(Cl)cc1)C(C)CC |
| InChI | InChI=1S/C17H26ClN3O2/c1-4-12(3)15(17(23)20-11-10-19-5-2)21-16(22)13-6-8-14(18)9-7-13/h6-9,12,15,19H,4-5,10-11H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | UJVYZCYBGBZAFJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|