C21H25ClN2O4 — CID 78796642
4-chloro-N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 78796642) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 78796642 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-chloro-N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CCC(C)C(NC(=O)c1ccc(Cl)cc1)C(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H25ClN2O4/c1-3-13(2)19(24-20(27)15-5-7-16(22)8-6-15)21(28)23-11-10-14-4-9-17(25)18(26)12-14/h4-9,12-13,19,25-26H,3,10-11H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | PJKNCVQFAFIVGD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|