C20H23ClN2O4 — CID 78797095
2-chloro-N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 78797095) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-chloro-N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 78797095 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-chloro-N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H23ClN2O4/c1-12(2)18(23-19(26)14-5-3-4-6-15(14)21)20(27)22-10-9-13-7-8-16(24)17(25)11-13/h3-8,11-12,18,24-25H,9-10H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | KOBNDNGYXSEVDX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|