C18H27ClN2O2 — CID 46447854
2-chloro-N-[3-methyl-1-(4-methylpentylamino)-1-oxobutan-2-yl]benzamide (PubChem CID 46447854) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-(4-methylpentylamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-(4-methylpentylamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 46447854 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-(4-methylpentylamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)CCCNC(=O)C(NC(=O)c1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C18H27ClN2O2/c1-12(2)8-7-11-20-18(23)16(13(3)4)21-17(22)14-9-5-6-10-15(14)19/h5-6,9-10,12-13,16H,7-8,11H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | BUDMSZNRCVIMJL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|