C18H27ClN4O2S — CID 9149789
2-chloro-N-[(2S)-3-methyl-1-[2-(3-methylbutylcarbamothioyl)hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 9149789) has the molecular formula C18H27ClN4O2S and a molecular weight of 398.96 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-3-methyl-1-[2-(3-methylbutylcarbamothioyl)hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(2S)-3-methyl-1-[2-(3-methylbutylcarbamothioyl)hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9149789 |
| Molecular Formula | C18H27ClN4O2S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-chloro-N-[(2S)-3-methyl-1-[2-(3-methylbutylcarbamothioyl)hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)CCNC(=S)NNC(=O)[C@@H](NC(=O)c1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C18H27ClN4O2S/c1-11(2)9-10-20-18(26)23-22-17(25)15(12(3)4)21-16(24)13-7-5-6-8-14(13)19/h5-8,11-12,15H,9-10H2,1-4H3,(H,21,24)(H,22,25)(H2,20,23,26)/t15-/m0/s1 |
| InChIKey | XLXRGMIUBLMJEC-HNNXBMFYSA-N |
| XLogP | 2.64 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|