C19H26ClN3O3 — CID 9327127
2-chloro-N-[(2S)-1-[2-(cyclohexanecarbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 9327127) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-[2-(cyclohexanecarbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(2S)-1-[2-(cyclohexanecarbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9327127 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-chloro-N-[(2S)-1-[2-(cyclohexanecarbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1Cl)C(=O)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-12(2)16(21-18(25)14-10-6-7-11-15(14)20)19(26)23-22-17(24)13-8-4-3-5-9-13/h6-7,10-13,16H,3-5,8-9H2,1-2H3,(H,21,25)(H,22,24)(H,23,26)/t16-/m0/s1 |
| InChIKey | CBFYGGJFPWSBIC-INIZCTEOSA-N |
| XLogP | 2.82 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|